C29H31N3O6 — CID 162643173
(2E,9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[4-(4-methylpiperazin-1-yl)anilino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 162643173) has the molecular formula C29H31N3O6 and a molecular weight of 517.58 g/mol. Its IUPAC name is (2E,9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[4-(4-methylpiperazin-1-yl)anilino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[4-(4-methylpiperazin-1-yl)anilino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 162643173 |
| Molecular Formula | C29H31N3O6 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[4-(4-methylpiperazin-1-yl)anilino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)Nc3ccc(N4CCN(C)CC4)cc3)C(=O)[C@@]12C |
| InChI | InChI=1S/C29H31N3O6/c1-15-25(35)23(17(3)33)27-24(26(15)36)29(4)21(38-27)14-20(34)22(28(29)37)16(2)30-18-6-8-19(9-7-18)32-12-10-31(5)11-13-32/h6-9,14,30,35-36H,10-13H2,1-5H3/b22-16+/t29-/m0/s1 |
| InChIKey | HDBXXTDPZUANHF-JROZDVGBSA-N |
| XLogP | 3.43 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|