C15H7F3N2O3 — CID 162643274
3-[5-(2,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid (PubChem CID 162643274) has the molecular formula C15H7F3N2O3 and a molecular weight of 320.23 g/mol. Its IUPAC name is 3-[5-(2,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid.
| Compound Name | 3-[5-(2,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 162643274 |
| Molecular Formula | C15H7F3N2O3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 3-[5-(2,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nnc(-c3cc(F)c(F)cc3F)o2)c1 |
| InChI | InChI=1S/C15H7F3N2O3/c16-10-6-12(18)11(17)5-9(10)14-20-19-13(23-14)7-2-1-3-8(4-7)15(21)22/h1-6H,(H,21,22) |
| InChIKey | WCYASILKGCUEGZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|