C28H26N6OS — CID 162643339
N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]naphthalene-1-carboxamide (PubChem CID 162643339) has the molecular formula C28H26N6OS and a molecular weight of 494.62 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 162643339 |
| Molecular Formula | C28H26N6OS |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[2-(dimethylamino)-5-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]naphthalene-1-carboxamide |
| SMILES | CN(C)c1ccc(Nc2ncnc3sc4c(c23)CCNC4)cc1NC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H26N6OS/c1-34(2)23-11-10-18(32-26-25-21-12-13-29-15-24(21)36-28(25)31-16-30-26)14-22(23)33-27(35)20-9-5-7-17-6-3-4-8-19(17)20/h3-11,14,16,29H,12-13,15H2,1-2H3,(H,33,35)(H,30,31,32) |
| InChIKey | CWXLHNDCSRFUSR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|