About [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate
[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate (PubChem CID 162643352) has the molecular formula C24H30N2O2
and a molecular weight of 378.52 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate.
Molecular Properties
| Compound Name | [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate |
| PubChem CID | 162643352 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate |
| SMILES | CC(C)c1ccc(NC(=O)OC2CCN(C3Cc4ccccc4C3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-17(2)18-7-9-21(10-8-18)25-24(27)28-23-11-13-26(14-12-23)22-15-19-5-3-4-6-20(19)16-22/h3-10,17,22-23H,11-16H2,1-2H3,(H,25,27) |
| InChIKey | CDBAAXNYHDKTFF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate?
The IUPAC name of [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate (CID 162643352) is [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate.
What is the SMILES notation for [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate?
The canonical SMILES for [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate is CC(C)c1ccc(NC(=O)OC2CCN(C3Cc4ccccc4C3)CC2)cc1.
What is the InChIKey of [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate?
The InChIKey is CDBAAXNYHDKTFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O2/c1-17(2)18-7-9-21(10-8-18)25-24(27)28-23-11-13-26(14-12-23)22-15-19-5-3-4-6-20(19)16-22/h3-10,17,22-23H,11-16H2,1-2H3,(H,25,27).
What are the key properties of [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate?
[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate has a molecular weight of 378.52 g/mol, XLogP of 4.99, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl] N-(4-propan-2-ylphenyl)carbamate is sourced from PubChem (CID 162643352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).