C23H34O7 — CID 162643368
[(4aS,4bS,6R,6aR,8S,10aR,10bS,12aS)-6-acetyloxy-6a-hydroxy-10a,12a-dimethyl-3-oxo-4,4a,4b,5,6,7,8,9,10,10b,11,12-dodecahydro-1H-naphtho[2,1-f]isochromen-8-yl] acetate (PubChem CID 162643368) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is [(4aS,4bS,6R,6aR,8S,10aR,10bS,12aS)-6-acetyloxy-6a-hydroxy-10a,12a-dimethyl-3-oxo-4,4a,4b,5,6,7,8,9,10,10b,11,12-dodecahydro-1H-naphtho[2,1-f]isochromen-8-yl] acetate.
| Compound Name | [(4aS,4bS,6R,6aR,8S,10aR,10bS,12aS)-6-acetyloxy-6a-hydroxy-10a,12a-dimethyl-3-oxo-4,4a,4b,5,6,7,8,9,10,10b,11,12-dodecahydro-1H-naphtho[2,1-f]isochromen-8-yl] acetate |
|---|---|
| PubChem CID | 162643368 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [(4aS,4bS,6R,6aR,8S,10aR,10bS,12aS)-6-acetyloxy-6a-hydroxy-10a,12a-dimethyl-3-oxo-4,4a,4b,5,6,7,8,9,10,10b,11,12-dodecahydro-1H-naphtho[2,1-f]isochromen-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)COC(=O)C[C@H]4[C@@H]3C[C@@H](OC(C)=O)[C@@]2(O)C1 |
| InChI | InChI=1S/C23H34O7/c1-13(24)29-15-5-8-22(4)17-6-7-21(3)12-28-20(26)10-18(21)16(17)9-19(30-14(2)25)23(22,27)11-15/h15-19,27H,5-12H2,1-4H3/t15-,16+,17-,18-,19+,21+,22+,23-/m0/s1 |
| InChIKey | KOZWJDCQAZJJDM-ARANEAMASA-N |
| XLogP | 2.77 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|