About 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea
1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea (PubChem CID 162643495) has the molecular formula C23H27FN4O
and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea.
Molecular Properties
| Compound Name | 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea |
| PubChem CID | 162643495 |
| Molecular Formula | C23H27FN4O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea |
| SMILES | Cc1cc(F)c(NC(=O)NCCC(C)(C)C)cc1-c1ccc2cc(N)ncc2c1 |
| InChI | InChI=1S/C23H27FN4O/c1-14-9-19(24)20(28-22(29)26-8-7-23(2,3)4)12-18(14)16-6-5-15-11-21(25)27-13-17(15)10-16/h5-6,9-13H,7-8H2,1-4H3,(H2,25,27)(H2,26,28,29) |
| InChIKey | GACBILLVSLDUPV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea?
The IUPAC name of 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea (CID 162643495) is 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea.
What is the SMILES notation for 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea?
The canonical SMILES for 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea is Cc1cc(F)c(NC(=O)NCCC(C)(C)C)cc1-c1ccc2cc(N)ncc2c1.
What is the InChIKey of 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea?
The InChIKey is GACBILLVSLDUPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27FN4O/c1-14-9-19(24)20(28-22(29)26-8-7-23(2,3)4)12-18(14)16-6-5-15-11-21(25)27-13-17(15)10-16/h5-6,9-13H,7-8H2,1-4H3,(H2,25,27)(H2,26,28,29).
What are the key properties of 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea?
1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea has a molecular weight of 394.49 g/mol, XLogP of 5.49, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3-aminoisoquinolin-7-yl)-2-fluoro-4-methylphenyl]-3-(3,3-dimethylbutyl)urea is sourced from PubChem (CID 162643495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).