About 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea
1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea (PubChem CID 162643601) has the molecular formula C16H12N6O2
and a molecular weight of 320.31 g/mol. Its IUPAC name is 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea.
Molecular Properties
| Compound Name | 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea |
| PubChem CID | 162643601 |
| Molecular Formula | C16H12N6O2 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea |
| SMILES | Nc1nc2ccc(NC(=O)Nc3ccnc4cccnc34)cc2o1 |
| InChI | InChI=1S/C16H12N6O2/c17-15-21-10-4-3-9(8-13(10)24-15)20-16(23)22-12-5-7-18-11-2-1-6-19-14(11)12/h1-8H,(H2,17,21)(H2,18,20,22,23) |
| InChIKey | JPUWQMPKAYFUDA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea?
The IUPAC name of 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea (CID 162643601) is 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea.
What is the SMILES notation for 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea?
The canonical SMILES for 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea is Nc1nc2ccc(NC(=O)Nc3ccnc4cccnc34)cc2o1.
What is the InChIKey of 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea?
The InChIKey is JPUWQMPKAYFUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N6O2/c17-15-21-10-4-3-9(8-13(10)24-15)20-16(23)22-12-5-7-18-11-2-1-6-19-14(11)12/h1-8H,(H2,17,21)(H2,18,20,22,23).
What are the key properties of 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea?
1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea has a molecular weight of 320.31 g/mol, XLogP of 3.00, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea is sourced from PubChem (CID 162643601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).