C27H30N2O6S — CID 162643613
2-methyl-5-(3,4,5-trimethoxyphenyl)-7-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine (PubChem CID 162643613) has the molecular formula C27H30N2O6S and a molecular weight of 510.61 g/mol. Its IUPAC name is 2-methyl-5-(3,4,5-trimethoxyphenyl)-7-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine.
| Compound Name | 2-methyl-5-(3,4,5-trimethoxyphenyl)-7-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine |
|---|---|
| PubChem CID | 162643613 |
| Molecular Formula | C27H30N2O6S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 2-methyl-5-(3,4,5-trimethoxyphenyl)-7-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine |
| SMILES | COc1cc(/C=C/C2=CC(c3cc(OC)c(OC)c(OC)c3)N3C=C(C)SC3=N2)cc(OC)c1OC |
| InChI | InChI=1S/C27H30N2O6S/c1-16-15-29-20(18-12-23(32-4)26(35-7)24(13-18)33-5)14-19(28-27(29)36-16)9-8-17-10-21(30-2)25(34-6)22(11-17)31-3/h8-15,20H,1-7H3/b9-8+ |
| InChIKey | DQFPGSMKHSLJFF-CMDGGOBGSA-N |
| XLogP | 5.66 |
| TPSA | 70.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |