C27H34N4O5S — CID 162643631
5-[4-(5,7-dimethoxy-4-thiomorpholin-4-ylquinazolin-2-yl)-2,6-dimethylphenoxy]-N-hydroxypentanamide (PubChem CID 162643631) has the molecular formula C27H34N4O5S and a molecular weight of 526.66 g/mol. Its IUPAC name is 5-[4-(5,7-dimethoxy-4-thiomorpholin-4-ylquinazolin-2-yl)-2,6-dimethylphenoxy]-N-hydroxypentanamide.
| Compound Name | 5-[4-(5,7-dimethoxy-4-thiomorpholin-4-ylquinazolin-2-yl)-2,6-dimethylphenoxy]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 162643631 |
| Molecular Formula | C27H34N4O5S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 5-[4-(5,7-dimethoxy-4-thiomorpholin-4-ylquinazolin-2-yl)-2,6-dimethylphenoxy]-N-hydroxypentanamide |
| SMILES | COc1cc(OC)c2c(N3CCSCC3)nc(-c3cc(C)c(OCCCCC(=O)NO)c(C)c3)nc2c1 |
| InChI | InChI=1S/C27H34N4O5S/c1-17-13-19(14-18(2)25(17)36-10-6-5-7-23(32)30-33)26-28-21-15-20(34-3)16-22(35-4)24(21)27(29-26)31-8-11-37-12-9-31/h13-16,33H,5-12H2,1-4H3,(H,30,32) |
| InChIKey | VQCRICWGWXEAJW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|