C22H24N4O3 — CID 162643649
N-[6-methoxy-2-[(E)-2-(4-nitrophenyl)ethenyl]quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 162643649) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[6-methoxy-2-[(E)-2-(4-nitrophenyl)ethenyl]quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[6-methoxy-2-[(E)-2-(4-nitrophenyl)ethenyl]quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 162643649 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[6-methoxy-2-[(E)-2-(4-nitrophenyl)ethenyl]quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | COc1ccc2nc(/C=C/c3ccc([N+](=O)[O-])cc3)cc(NCCN(C)C)c2c1 |
| InChI | InChI=1S/C22H24N4O3/c1-25(2)13-12-23-22-14-17(24-21-11-10-19(29-3)15-20(21)22)7-4-16-5-8-18(9-6-16)26(27)28/h4-11,14-15H,12-13H2,1-3H3,(H,23,24)/b7-4+ |
| InChIKey | LWSOKHICKVGMJT-QPJJXVBHSA-N |
| XLogP | 4.30 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|