C29H27BI4N4 — CID 162643865
5,11-diiodo-4,6,10,12-tetramethyl-2,2-bis[2-(1-methylpyridin-1-ium-4-yl)ethynyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene diiodide (PubChem CID 162643865) has the molecular formula C29H27BI4N4 and a molecular weight of 949.99 g/mol. Its IUPAC name is 5,11-diiodo-4,6,10,12-tetramethyl-2,2-bis[2-(1-methylpyridin-1-ium-4-yl)ethynyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene diiodide.
| Compound Name | 5,11-diiodo-4,6,10,12-tetramethyl-2,2-bis[2-(1-methylpyridin-1-ium-4-yl)ethynyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene diiodide |
|---|---|
| PubChem CID | 162643865 |
| Molecular Formula | C29H27BI4N4 |
| Molecular Weight | 949.99 g/mol |
| Exact Mass | 949.85 |
| IUPAC Name | 5,11-diiodo-4,6,10,12-tetramethyl-2,2-bis[2-(1-methylpyridin-1-ium-4-yl)ethynyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene diiodide |
| SMILES | CC1=C(I)C(C)=[N+]2C1=Cc1c(C)c(I)c(C)n1[B-]2(C#Cc1cc[n+](C)cc1)C#Cc1cc[n+](C)cc1.[I-].[I-] |
| InChI | InChI=1S/C29H27BI2N4.2HI/c1-20-26-19-27-21(2)29(32)23(4)36(27)30(35(26)22(3)28(20)31,13-7-24-9-15-33(5)16-10-24)14-8-25-11-17-34(6)18-12-25;;/h9-12,15-19H,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | DKFIYZLSOZVKGQ-UHFFFAOYSA-L |
| XLogP | -1.61 |
| TPSA | 15.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.99 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|