C41H24F12N6 — CID 162643901
4-[15-[4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]-10-(2,3,5,6-tetrafluorophenyl)-23,24-dihydro-22H-corrin-5-yl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline (PubChem CID 162643901) has the molecular formula C41H24F12N6 and a molecular weight of 828.66 g/mol. Its IUPAC name is 4-[15-[4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]-10-(2,3,5,6-tetrafluorophenyl)-23,24-dihydro-22H-corrin-5-yl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline.
| Compound Name | 4-[15-[4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]-10-(2,3,5,6-tetrafluorophenyl)-23,24-dihydro-22H-corrin-5-yl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 162643901 |
| Molecular Formula | C41H24F12N6 |
| Molecular Weight | 828.66 g/mol |
| Exact Mass | 828.19 |
| IUPAC Name | 4-[15-[4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]-10-(2,3,5,6-tetrafluorophenyl)-23,24-dihydro-22H-corrin-5-yl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline |
| SMILES | CN(C)c1c(F)c(F)c(-c2c3nc(c4ccc([nH]4)c(-c4c(F)c(F)c(N(C)C)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)cc(F)c4F)c4ccc2[nH]4)C=C3)c(F)c1F |
| InChI | InChI=1S/C41H24F12N6/c1-58(2)40-36(50)32(46)28(33(47)37(40)51)25-18-7-5-16(54-18)17-6-8-19(55-17)26(29-34(48)38(52)41(59(3)4)39(53)35(29)49)23-12-10-21(57-23)24(20-9-11-22(25)56-20)27-30(44)14(42)13-15(43)31(27)45/h5-13,54,56-57H,1-4H3/b17-16-,24-20+,24-21+,25-18+,25-22+,26-19+,26-23+ |
| InChIKey | QTAQFJHIDFPBIX-NTJADFIASA-N |
| XLogP | 11.50 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.66 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|