C29H37N5O2 — CID 162643909
N-hydroxy-4-[3-[4-[[[(1S,2R)-2-[4-(1-methylpyrazol-4-yl)phenyl]cyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzamide (PubChem CID 162643909) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-hydroxy-4-[3-[4-[[[(1S,2R)-2-[4-(1-methylpyrazol-4-yl)phenyl]cyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzamide.
| Compound Name | N-hydroxy-4-[3-[4-[[[(1S,2R)-2-[4-(1-methylpyrazol-4-yl)phenyl]cyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 162643909 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-hydroxy-4-[3-[4-[[[(1S,2R)-2-[4-(1-methylpyrazol-4-yl)phenyl]cyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzamide |
| SMILES | Cn1cc(-c2ccc([C@H]3C[C@@H]3NCC3CCN(CCCc4ccc(C(=O)NO)cc4)CC3)cc2)cn1 |
| InChI | InChI=1S/C29H37N5O2/c1-33-20-26(19-31-33)23-8-10-24(11-9-23)27-17-28(27)30-18-22-12-15-34(16-13-22)14-2-3-21-4-6-25(7-5-21)29(35)32-36/h4-11,19-20,22,27-28,30,36H,2-3,12-18H2,1H3,(H,32,35)/t27-,28+/m1/s1 |
| InChIKey | RHYDLZPXYPVUIP-IZLXSDGUSA-N |
| XLogP | 4.00 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|