C23H29FO7 — CID 162643933
[(1R,2R,5R,6R,8S,13R,14R)-2,13,14-trihydroxy-1,5,13-trimethyl-9,11-dioxatetracyclo[6.4.1.16,10.02,6]tetradecan-8-yl] 2-(4-fluorophenyl)acetate (PubChem CID 162643933) has the molecular formula C23H29FO7 and a molecular weight of 436.48 g/mol. Its IUPAC name is [(1R,2R,5R,6R,8S,13R,14R)-2,13,14-trihydroxy-1,5,13-trimethyl-9,11-dioxatetracyclo[6.4.1.16,10.02,6]tetradecan-8-yl] 2-(4-fluorophenyl)acetate.
| Compound Name | [(1R,2R,5R,6R,8S,13R,14R)-2,13,14-trihydroxy-1,5,13-trimethyl-9,11-dioxatetracyclo[6.4.1.16,10.02,6]tetradecan-8-yl] 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 162643933 |
| Molecular Formula | C23H29FO7 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | [(1R,2R,5R,6R,8S,13R,14R)-2,13,14-trihydroxy-1,5,13-trimethyl-9,11-dioxatetracyclo[6.4.1.16,10.02,6]tetradecan-8-yl] 2-(4-fluorophenyl)acetate |
| SMILES | C[C@@H]1CC[C@@]2(O)[C@]13C[C@@]1(OC(=O)Cc4ccc(F)cc4)OC(OC[C@@]2(C)[C@@]1(C)O)[C@@H]3O |
| InChI | InChI=1S/C23H29FO7/c1-13-8-9-22(28)19(2)12-29-18-17(26)21(13,22)11-23(31-18,20(19,3)27)30-16(25)10-14-4-6-15(24)7-5-14/h4-7,13,17-18,26-28H,8-12H2,1-3H3/t13-,17+,18?,19+,20-,21-,22+,23-/m1/s1 |
| InChIKey | IXIXEWWBGALEOU-OEFHAVRBSA-N |
| XLogP | 1.66 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |