C19H22N2O4 — CID 162643961
3-[2-(4-benzoylpiperazin-1-yl)ethoxy]-2-methylpyran-4-one (PubChem CID 162643961) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-[2-(4-benzoylpiperazin-1-yl)ethoxy]-2-methylpyran-4-one.
| Compound Name | 3-[2-(4-benzoylpiperazin-1-yl)ethoxy]-2-methylpyran-4-one |
|---|---|
| PubChem CID | 162643961 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-[2-(4-benzoylpiperazin-1-yl)ethoxy]-2-methylpyran-4-one |
| SMILES | Cc1occc(=O)c1OCCN1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2O4/c1-15-18(17(22)7-13-24-15)25-14-12-20-8-10-21(11-9-20)19(23)16-5-3-2-4-6-16/h2-7,13H,8-12,14H2,1H3 |
| InChIKey | CLMBQXIZKJAQAQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |