C24H23N5O3S — CID 162644068
N-[3-[6-(4-amino-3-methoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]phenyl]morpholine-4-carboxamide (PubChem CID 162644068) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[3-[6-(4-amino-3-methoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]phenyl]morpholine-4-carboxamide.
| Compound Name | N-[3-[6-(4-amino-3-methoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 162644068 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[3-[6-(4-amino-3-methoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]phenyl]morpholine-4-carboxamide |
| SMILES | COc1cc(-c2cnc3c(-c4cccc(NC(=O)N5CCOCC5)c4)snc3c2)ccc1N |
| InChI | InChI=1S/C24H23N5O3S/c1-31-21-13-15(5-6-19(21)25)17-12-20-22(26-14-17)23(33-28-20)16-3-2-4-18(11-16)27-24(30)29-7-9-32-10-8-29/h2-6,11-14H,7-10,25H2,1H3,(H,27,30) |
| InChIKey | RKKXNLSIYBRUEL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|