About 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde
11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde (PubChem CID 162644105) has the molecular formula C26H23NO3
and a molecular weight of 397.47 g/mol. Its IUPAC name is 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde |
| PubChem CID | 162644105 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde |
| SMILES | COc1ccc2c(c1)c1cc(C=O)c3c(c1n2Cc1ccccc1)C=CC(C)(C)O3 |
| InChI | InChI=1S/C26H23NO3/c1-26(2)12-11-20-24-22(13-18(16-28)25(20)30-26)21-14-19(29-3)9-10-23(21)27(24)15-17-7-5-4-6-8-17/h4-14,16H,15H2,1-3H3 |
| InChIKey | QVKZCPCVQHUFDP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde?
The IUPAC name of 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde (CID 162644105) is 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde.
What is the SMILES notation for 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde?
The canonical SMILES for 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde is COc1ccc2c(c1)c1cc(C=O)c3c(c1n2Cc1ccccc1)C=CC(C)(C)O3.
What is the InChIKey of 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde?
The InChIKey is QVKZCPCVQHUFDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO3/c1-26(2)12-11-20-24-22(13-18(16-28)25(20)30-26)21-14-19(29-3)9-10-23(21)27(24)15-17-7-5-4-6-8-17/h4-14,16H,15H2,1-3H3.
What are the key properties of 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde?
11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde has a molecular weight of 397.47 g/mol, XLogP of 5.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole-5-carbaldehyde is sourced from PubChem (CID 162644105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).