About cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone
cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone (PubChem CID 162644241) has the molecular formula C12H10Cl2O2
and a molecular weight of 257.12 g/mol. Its IUPAC name is cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone |
| PubChem CID | 162644241 |
| Molecular Formula | C12H10Cl2O2 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone |
| SMILES | O=C(C1=CCCC1)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2O2/c13-9-5-8(6-10(14)12(9)16)11(15)7-3-1-2-4-7/h3,5-6,16H,1-2,4H2 |
| InChIKey | YKBXGXJAWKFTON-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone?
The IUPAC name of cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone (CID 162644241) is cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone.
What is the SMILES notation for cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone?
The canonical SMILES for cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone is O=C(C1=CCCC1)c1cc(Cl)c(O)c(Cl)c1.
What is the InChIKey of cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone?
The InChIKey is YKBXGXJAWKFTON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2O2/c13-9-5-8(6-10(14)12(9)16)11(15)7-3-1-2-4-7/h3,5-6,16H,1-2,4H2.
What are the key properties of cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone?
cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone has a molecular weight of 257.12 g/mol, XLogP of 3.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl-(3,5-dichloro-4-hydroxyphenyl)methanone is sourced from PubChem (CID 162644241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).