C28H36N4O6 — CID 162644270
5-[4-[5,7-dimethoxy-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-2,6-dimethylphenoxy]-N-hydroxypentanamide (PubChem CID 162644270) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is 5-[4-[5,7-dimethoxy-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-2,6-dimethylphenoxy]-N-hydroxypentanamide.
| Compound Name | 5-[4-[5,7-dimethoxy-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-2,6-dimethylphenoxy]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 162644270 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 5-[4-[5,7-dimethoxy-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-2,6-dimethylphenoxy]-N-hydroxypentanamide |
| SMILES | COc1cc(OC)c2c(N3CCOC[C@H]3C)nc(-c3cc(C)c(OCCCCC(=O)NO)c(C)c3)nc2c1 |
| InChI | InChI=1S/C28H36N4O6/c1-17-12-20(13-18(2)26(17)38-10-7-6-8-24(33)31-34)27-29-22-14-21(35-4)15-23(36-5)25(22)28(30-27)32-9-11-37-16-19(32)3/h12-15,19,34H,6-11,16H2,1-5H3,(H,31,33)/t19-/m1/s1 |
| InChIKey | ZXEMBIZIHDNZDF-LJQANCHMSA-N |
| XLogP | 4.21 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|