C18H24N2O3 — CID 162644278
methyl 4-[(2,2,4-trimethyl-1H-quinoline-8-carbonyl)amino]butanoate (PubChem CID 162644278) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 4-[(2,2,4-trimethyl-1H-quinoline-8-carbonyl)amino]butanoate.
| Compound Name | methyl 4-[(2,2,4-trimethyl-1H-quinoline-8-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 162644278 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | methyl 4-[(2,2,4-trimethyl-1H-quinoline-8-carbonyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1cccc2c1NC(C)(C)C=C2C |
| InChI | InChI=1S/C18H24N2O3/c1-12-11-18(2,3)20-16-13(12)7-5-8-14(16)17(22)19-10-6-9-15(21)23-4/h5,7-8,11,20H,6,9-10H2,1-4H3,(H,19,22) |
| InChIKey | HPPLRDLUGNOBTP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|