About 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline
4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline (PubChem CID 162644431) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline.
Molecular Properties
| Compound Name | 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline |
| PubChem CID | 162644431 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline |
| SMILES | Cc1cc(OCCN)cc(C)c1Cc1ccc(N)cc1 |
| InChI | InChI=1S/C17H22N2O/c1-12-9-16(20-8-7-18)10-13(2)17(12)11-14-3-5-15(19)6-4-14/h3-6,9-10H,7-8,11,18-19H2,1-2H3 |
| InChIKey | OGAAIXJYFARWPV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline?
The IUPAC name of 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline (CID 162644431) is 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline.
What is the SMILES notation for 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline?
The canonical SMILES for 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline is Cc1cc(OCCN)cc(C)c1Cc1ccc(N)cc1.
What is the InChIKey of 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline?
The InChIKey is OGAAIXJYFARWPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-12-9-16(20-8-7-18)10-13(2)17(12)11-14-3-5-15(19)6-4-14/h3-6,9-10H,7-8,11,18-19H2,1-2H3.
What are the key properties of 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline?
4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline has a molecular weight of 270.38 g/mol, XLogP of 2.81, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2-aminoethoxy)-2,6-dimethylphenyl]methyl]aniline is sourced from PubChem (CID 162644431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).