C29H29N7O — CID 162644460
1-(4-tert-butylphenyl)-3-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]urea (PubChem CID 162644460) has the molecular formula C29H29N7O and a molecular weight of 491.60 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 162644460 |
| Molecular Formula | C29H29N7O |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]urea |
| SMILES | Cn1cc(-c2ccc3c(Nc4cccc(NC(=O)Nc5ccc(C(C)(C)C)cc5)c4)ncnc3c2)cn1 |
| InChI | InChI=1S/C29H29N7O/c1-29(2,3)21-9-11-22(12-10-21)34-28(37)35-24-7-5-6-23(15-24)33-27-25-13-8-19(14-26(25)30-18-31-27)20-16-32-36(4)17-20/h5-18H,1-4H3,(H,30,31,33)(H2,34,35,37) |
| InChIKey | AUDZDWOFAGUFFM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |