C19H23N7O4 — CID 162644510
tert-butyl N-[2-[[5-amino-2-(3-hydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carbonyl]amino]ethyl]carbamate (PubChem CID 162644510) has the molecular formula C19H23N7O4 and a molecular weight of 413.44 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-amino-2-(3-hydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-amino-2-(3-hydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 162644510 |
| Molecular Formula | C19H23N7O4 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | tert-butyl N-[2-[[5-amino-2-(3-hydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1cnc(N)n2nc(-c3cccc(O)c3)nc12 |
| InChI | InChI=1S/C19H23N7O4/c1-19(2,3)30-18(29)22-8-7-21-16(28)13-10-23-17(20)26-15(13)24-14(25-26)11-5-4-6-12(27)9-11/h4-6,9-10,27H,7-8H2,1-3H3,(H2,20,23)(H,21,28)(H,22,29) |
| InChIKey | UNZYMRVJUQQUKI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 156.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|