C19H16FNO2 — CID 162644592
(1S,9R,11S)-11-(4-fluorophenyl)-10-oxa-15-azatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-trien-14-one (PubChem CID 162644592) has the molecular formula C19H16FNO2 and a molecular weight of 309.34 g/mol. Its IUPAC name is (1S,9R,11S)-11-(4-fluorophenyl)-10-oxa-15-azatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-trien-14-one.
| Compound Name | (1S,9R,11S)-11-(4-fluorophenyl)-10-oxa-15-azatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-trien-14-one |
|---|---|
| PubChem CID | 162644592 |
| Molecular Formula | C19H16FNO2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (1S,9R,11S)-11-(4-fluorophenyl)-10-oxa-15-azatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-trien-14-one |
| SMILES | O=C1CC[C@@]2(c3ccc(F)cc3)O[C@@H]3Cc4ccccc4[C@@H]3N12 |
| InChI | InChI=1S/C19H16FNO2/c20-14-7-5-13(6-8-14)19-10-9-17(22)21(19)18-15-4-2-1-3-12(15)11-16(18)23-19/h1-8,16,18H,9-11H2/t16-,18+,19+/m1/s1 |
| InChIKey | OUXAAQNUFJWIDT-NEWSRXKRSA-N |
| XLogP | 3.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |