About [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol
[3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol (PubChem CID 162644698) has the molecular formula C23H22N2O4
and a molecular weight of 390.44 g/mol. Its IUPAC name is [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol.
Molecular Properties
| Compound Name | [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol |
| PubChem CID | 162644698 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol |
| SMILES | COc1cc(-c2cccc(-c3cn(CO)c4ccccc34)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H22N2O4/c1-27-21-11-15(12-22(28-2)23(21)29-3)18-8-6-9-19(24-18)17-13-25(14-26)20-10-5-4-7-16(17)20/h4-13,26H,14H2,1-3H3 |
| InChIKey | CQVSTHRMEAGNDL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol?
The IUPAC name of [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol (CID 162644698) is [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol.
What is the SMILES notation for [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol?
The canonical SMILES for [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol is COc1cc(-c2cccc(-c3cn(CO)c4ccccc34)n2)cc(OC)c1OC.
What is the InChIKey of [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol?
The InChIKey is CQVSTHRMEAGNDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O4/c1-27-21-11-15(12-22(28-2)23(21)29-3)18-8-6-9-19(24-18)17-13-25(14-26)20-10-5-4-7-16(17)20/h4-13,26H,14H2,1-3H3.
What are the key properties of [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol?
[3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol has a molecular weight of 390.44 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]indol-1-yl]methanol is sourced from PubChem (CID 162644698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).