C21H23F5N4O — CID 162644729
2-[4-(dimethylamino)phenyl]-N-[(3S,4R)-4-[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide (PubChem CID 162644729) has the molecular formula C21H23F5N4O and a molecular weight of 442.43 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-[(3S,4R)-4-[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-[(3S,4R)-4-[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 162644729 |
| Molecular Formula | C21H23F5N4O |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-[(3S,4R)-4-[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]pyrrolidin-3-yl]acetamide |
| SMILES | CN(C)c1ccc(CC(=O)N[C@@H]2CNC[C@H]2c2ccc(C(F)(F)C(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C21H23F5N4O/c1-30(2)15-6-3-13(4-7-15)9-19(31)29-17-12-27-11-16(17)14-5-8-18(28-10-14)20(22,23)21(24,25)26/h3-8,10,16-17,27H,9,11-12H2,1-2H3,(H,29,31)/t16-,17+/m0/s1 |
| InChIKey | LBSAERBARRVFRT-DLBZAZTESA-N |
| XLogP | 3.22 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|