C21H19N7O3 — CID 162644794
ethyl 2-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]amino]-2-phenylacetate (PubChem CID 162644794) has the molecular formula C21H19N7O3 and a molecular weight of 417.43 g/mol. Its IUPAC name is ethyl 2-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]amino]-2-phenylacetate.
| Compound Name | ethyl 2-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 162644794 |
| Molecular Formula | C21H19N7O3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | ethyl 2-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]amino]-2-phenylacetate |
| SMILES | CCOC(=O)C(Nc1nc2nn(C)cc2c2nc(-c3ccco3)nn12)c1ccccc1 |
| InChI | InChI=1S/C21H19N7O3/c1-3-30-20(29)16(13-8-5-4-6-9-13)22-21-24-17-14(12-27(2)25-17)19-23-18(26-28(19)21)15-10-7-11-31-15/h4-12,16H,3H2,1-2H3,(H,22,24,25) |
| InChIKey | YWPXUUWVCDDDOD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |