About 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine
3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine (PubChem CID 162644908) has the molecular formula C22H21N3O
and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine |
| PubChem CID | 162644908 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine |
| SMILES | COc1ccc(-c2cnc3cnc(-c4ccc(C(C)C)cc4)cn23)cc1 |
| InChI | InChI=1S/C22H21N3O/c1-15(2)16-4-6-17(7-5-16)20-14-25-21(12-24-22(25)13-23-20)18-8-10-19(26-3)11-9-18/h4-15H,1-3H3 |
| InChIKey | QQBXCXABKWTKBZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine?
The IUPAC name of 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine (CID 162644908) is 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine.
What is the SMILES notation for 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine?
The canonical SMILES for 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine is COc1ccc(-c2cnc3cnc(-c4ccc(C(C)C)cc4)cn23)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine?
The InChIKey is QQBXCXABKWTKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O/c1-15(2)16-4-6-17(7-5-16)20-14-25-21(12-24-22(25)13-23-20)18-8-10-19(26-3)11-9-18/h4-15H,1-3H3.
What are the key properties of 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine?
3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine has a molecular weight of 343.43 g/mol, XLogP of 5.20, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)imidazo[1,2-a]pyrazine is sourced from PubChem (CID 162644908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).