About (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol
(2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol (PubChem CID 162644959) has the molecular formula C16H25N5O
and a molecular weight of 303.41 g/mol. Its IUPAC name is (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol |
| PubChem CID | 162644959 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol |
| SMILES | CCCCCC[C@](C)(CO)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C16H25N5O/c1-3-4-5-6-9-16(2,11-22)21-14-13-12(8-7-10-18-13)19-15(17)20-14/h7-8,10,22H,3-6,9,11H2,1-2H3,(H3,17,19,20,21)/t16-/m1/s1 |
| InChIKey | VUMLYPPIWBKCFP-MRXNPFEDSA-N |
| XLogP | 2.74 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol?
The IUPAC name of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol (CID 162644959) is (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol.
What is the SMILES notation for (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol?
The canonical SMILES for (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol is CCCCCC[C@](C)(CO)Nc1nc(N)nc2cccnc12.
What is the InChIKey of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol?
The InChIKey is VUMLYPPIWBKCFP-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H25N5O/c1-3-4-5-6-9-16(2,11-22)21-14-13-12(8-7-10-18-13)19-15(17)20-14/h7-8,10,22H,3-6,9,11H2,1-2H3,(H3,17,19,20,21)/t16-/m1/s1.
What are the key properties of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol?
(2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol has a molecular weight of 303.41 g/mol, XLogP of 2.74, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methyloctan-1-ol is sourced from PubChem (CID 162644959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).