About 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid
3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid (PubChem CID 162644964) has the molecular formula C20H14Cl2N2O3
and a molecular weight of 401.25 g/mol. Its IUPAC name is 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid.
Molecular Properties
| Compound Name | 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid |
| PubChem CID | 162644964 |
| Molecular Formula | C20H14Cl2N2O3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid |
| SMILES | O=C(Nc1ccc(-c2cccc(Cl)c2Cl)cc1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H14Cl2N2O3/c21-17-6-2-5-16(18(17)22)12-7-9-14(10-8-12)23-20(27)24-15-4-1-3-13(11-15)19(25)26/h1-11H,(H,25,26)(H2,23,24,27) |
| InChIKey | GFQMFLFEBXVVBG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid?
The IUPAC name of 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid (CID 162644964) is 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid.
What is the SMILES notation for 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid?
The canonical SMILES for 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid is O=C(Nc1ccc(-c2cccc(Cl)c2Cl)cc1)Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid?
The InChIKey is GFQMFLFEBXVVBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2N2O3/c21-17-6-2-5-16(18(17)22)12-7-9-14(10-8-12)23-20(27)24-15-4-1-3-13(11-15)19(25)26/h1-11H,(H,25,26)(H2,23,24,27).
What are the key properties of 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid?
3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid has a molecular weight of 401.25 g/mol, XLogP of 6.00, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2,3-dichlorophenyl)phenyl]carbamoylamino]benzoic acid is sourced from PubChem (CID 162644964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).