C19H20N2O3 — CID 162645111
13-[(2,5-dimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene (PubChem CID 162645111) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 13-[(2,5-dimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene.
| Compound Name | 13-[(2,5-dimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene |
|---|---|
| PubChem CID | 162645111 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 13-[(2,5-dimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene |
| SMILES | COc1ccc(OC)c(Cn2ccc3c2-c2oncc2CCC3)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-22-16-6-7-17(23-2)15(10-16)12-21-9-8-13-4-3-5-14-11-20-24-19(14)18(13)21/h6-11H,3-5,12H2,1-2H3 |
| InChIKey | JRBANUQCBQUJPL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |