C13H18O7 — CID 162645188
methyl (4S,4aR,5S,7R,7aS)-7-acetyloxy-5-hydroxy-7-methyl-1-oxo-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 162645188) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is methyl (4S,4aR,5S,7R,7aS)-7-acetyloxy-5-hydroxy-7-methyl-1-oxo-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (4S,4aR,5S,7R,7aS)-7-acetyloxy-5-hydroxy-7-methyl-1-oxo-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 162645188 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl (4S,4aR,5S,7R,7aS)-7-acetyloxy-5-hydroxy-7-methyl-1-oxo-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)[C@@H]1COC(=O)[C@H]2[C@@H]1[C@@H](O)C[C@@]2(C)OC(C)=O |
| InChI | InChI=1S/C13H18O7/c1-6(14)20-13(2)4-8(15)9-7(11(16)18-3)5-19-12(17)10(9)13/h7-10,15H,4-5H2,1-3H3/t7-,8+,9+,10-,13-/m1/s1 |
| InChIKey | BOILOAUEIFWFPM-RWOMURPVSA-N |
| XLogP | -0.35 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|