C28H26N2O4 — CID 162645208
[(13aR)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl] pyridine-3-carboxylate (PubChem CID 162645208) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is [(13aR)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl] pyridine-3-carboxylate.
| Compound Name | [(13aR)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 162645208 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [(13aR)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl] pyridine-3-carboxylate |
| SMILES | COc1cc2c3c(c4ccc(OC(=O)c5cccnc5)cc4c2cc1OC)CN1CCC[C@@H]1C3 |
| InChI | InChI=1S/C28H26N2O4/c1-32-26-13-23-21-11-18-6-4-10-30(18)16-25(21)20-8-7-19(12-22(20)24(23)14-27(26)33-2)34-28(31)17-5-3-9-29-15-17/h3,5,7-9,12-15,18H,4,6,10-11,16H2,1-2H3/t18-/m1/s1 |
| InChIKey | XWCYXOGNXFDUKF-GOSISDBHSA-N |
| XLogP | 5.14 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|