About (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol
(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol (PubChem CID 162645221) has the molecular formula C15H15BO5S
and a molecular weight of 318.16 g/mol. Its IUPAC name is (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol.
Molecular Properties
| Compound Name | (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol |
| PubChem CID | 162645221 |
| Molecular Formula | C15H15BO5S |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol |
| SMILES | CS(=O)(=O)c1ccc(C(O)c2ccc3c(c2)B(O)OC3)cc1 |
| InChI | InChI=1S/C15H15BO5S/c1-22(19,20)13-6-4-10(5-7-13)15(17)11-2-3-12-9-21-16(18)14(12)8-11/h2-8,15,17-18H,9H2,1H3 |
| InChIKey | PIEFDRLLVVGCKE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol?
The IUPAC name of (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol (CID 162645221) is (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol.
What is the SMILES notation for (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol?
The canonical SMILES for (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol is CS(=O)(=O)c1ccc(C(O)c2ccc3c(c2)B(O)OC3)cc1.
What is the InChIKey of (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol?
The InChIKey is PIEFDRLLVVGCKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BO5S/c1-22(19,20)13-6-4-10(5-7-13)15(17)11-2-3-12-9-21-16(18)14(12)8-11/h2-8,15,17-18H,9H2,1H3.
What are the key properties of (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol?
(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol has a molecular weight of 318.16 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-(4-methylsulfonylphenyl)methanol is sourced from PubChem (CID 162645221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).