C19H16Cl2N2O2 — CID 162645262
(1R,3S)-1-(2,4-dichlorophenyl)-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 162645262) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is (1R,3S)-1-(2,4-dichlorophenyl)-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (1R,3S)-1-(2,4-dichlorophenyl)-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 162645262 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (1R,3S)-1-(2,4-dichlorophenyl)-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | C[C@]1(c2ccc(Cl)cc2Cl)N[C@H](C(=O)O)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-19(13-7-6-10(20)8-14(13)21)17-12(9-16(23-19)18(24)25)11-4-2-3-5-15(11)22-17/h2-8,16,22-23H,9H2,1H3,(H,24,25)/t16-,19+/m0/s1 |
| InChIKey | UKUMXGWYVYZVSU-QFBILLFUSA-N |
| XLogP | 4.34 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |