C16H15F3N4O6 — CID 162645304
[(7S)-7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl]methyl N-[4-(trifluoromethoxy)phenyl]carbamate (PubChem CID 162645304) has the molecular formula C16H15F3N4O6 and a molecular weight of 416.31 g/mol. Its IUPAC name is [(7S)-7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl]methyl N-[4-(trifluoromethoxy)phenyl]carbamate.
| Compound Name | [(7S)-7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl]methyl N-[4-(trifluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 162645304 |
| Molecular Formula | C16H15F3N4O6 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | [(7S)-7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl]methyl N-[4-(trifluoromethoxy)phenyl]carbamate |
| SMILES | C[C@@]1(COC(=O)Nc2ccc(OC(F)(F)F)cc2)CCn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C16H15F3N4O6/c1-15(6-7-22-8-12(23(25)26)21-13(22)29-15)9-27-14(24)20-10-2-4-11(5-3-10)28-16(17,18)19/h2-5,8H,6-7,9H2,1H3,(H,20,24)/t15-/m0/s1 |
| InChIKey | HBJBNGLJCUFYIO-HNNXBMFYSA-N |
| XLogP | 3.48 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|