C25H22N4O3 — CID 162645343
N-(3-nitrophenyl)-2-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)acetamide (PubChem CID 162645343) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)acetamide.
| Compound Name | N-(3-nitrophenyl)-2-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)acetamide |
|---|---|
| PubChem CID | 162645343 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-(3-nitrophenyl)-2-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)acetamide |
| SMILES | O=C(CN1CCc2c([nH]c3ccccc23)C1c1ccccc1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22N4O3/c30-23(26-18-9-6-10-19(15-18)29(31)32)16-28-14-13-21-20-11-4-5-12-22(20)27-24(21)25(28)17-7-2-1-3-8-17/h1-12,15,25,27H,13-14,16H2,(H,26,30) |
| InChIKey | KRSDCGWQDZATLP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|