C26H27N5O2S — CID 162645451
(E)-3-[3,5-dimethyl-4-[2-[4-[(1-oxo-1,4-thiazinan-4-yl)methyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile (PubChem CID 162645451) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-4-[2-[4-[(1-oxo-1,4-thiazinan-4-yl)methyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[3,5-dimethyl-4-[2-[4-[(1-oxo-1,4-thiazinan-4-yl)methyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 162645451 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | (E)-3-[3,5-dimethyl-4-[2-[4-[(1-oxo-1,4-thiazinan-4-yl)methyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1ccnc(Nc2ccc(CN3CCS(=O)CC3)cc2)n1 |
| InChI | InChI=1S/C26H27N5O2S/c1-19-16-22(4-3-10-27)17-20(2)25(19)33-24-9-11-28-26(30-24)29-23-7-5-21(6-8-23)18-31-12-14-34(32)15-13-31/h3-9,11,16-17H,12-15,18H2,1-2H3,(H,28,29,30)/b4-3+ |
| InChIKey | QZWRXBLAOPTWIV-ONEGZZNKSA-N |
| XLogP | 4.73 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|