C13H18N2O2 — CID 162645454
(2S)-2-[(2S)-1-methylpyrrolidin-2-yl]-2,3-dihydro-1,4-benzodioxin-5-amine (PubChem CID 162645454) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2S)-2-[(2S)-1-methylpyrrolidin-2-yl]-2,3-dihydro-1,4-benzodioxin-5-amine.
| Compound Name | (2S)-2-[(2S)-1-methylpyrrolidin-2-yl]-2,3-dihydro-1,4-benzodioxin-5-amine |
|---|---|
| PubChem CID | 162645454 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2S)-2-[(2S)-1-methylpyrrolidin-2-yl]-2,3-dihydro-1,4-benzodioxin-5-amine |
| SMILES | CN1CCC[C@H]1[C@H]1COc2c(N)cccc2O1 |
| InChI | InChI=1S/C13H18N2O2/c1-15-7-3-5-10(15)12-8-16-13-9(14)4-2-6-11(13)17-12/h2,4,6,10,12H,3,5,7-8,14H2,1H3/t10-,12+/m0/s1 |
| InChIKey | NRJVMOFFYPPJEG-CMPLNLGQSA-N |
| XLogP | 1.50 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|