C19H25N5 — CID 162645460
4-N,6-dimethyl-2-N-[4-methyl-3-(2,3,4,7-tetrahydro-1H-azepin-5-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 162645460) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-N,6-dimethyl-2-N-[4-methyl-3-(2,3,4,7-tetrahydro-1H-azepin-5-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N,6-dimethyl-2-N-[4-methyl-3-(2,3,4,7-tetrahydro-1H-azepin-5-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 162645460 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 4-N,6-dimethyl-2-N-[4-methyl-3-(2,3,4,7-tetrahydro-1H-azepin-5-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CNc1cc(C)nc(Nc2ccc(C)c(C3=CCNCCC3)c2)n1 |
| InChI | InChI=1S/C19H25N5/c1-13-6-7-16(12-17(13)15-5-4-9-21-10-8-15)23-19-22-14(2)11-18(20-3)24-19/h6-8,11-12,21H,4-5,9-10H2,1-3H3,(H2,20,22,23,24) |
| InChIKey | YBKZQRANOVULPZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |