About dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate
dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate (PubChem CID 162645496) has the molecular formula C12H16Li2NO3PS
and a molecular weight of 299.19 g/mol. Its IUPAC name is dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate.
Molecular Properties
| Compound Name | dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate |
| PubChem CID | 162645496 |
| Molecular Formula | C12H16Li2NO3PS |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate |
| SMILES | CC(C)C[C@H](NP([O-])(=S)c1ccccc1)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C12H18NO3PS.2Li/c1-9(2)8-11(12(14)15)13-17(16,18)10-6-4-3-5-7-10;;/h3-7,9,11H,8H2,1-2H3,(H,14,15)(H2,13,16,18);;/q;2*+1/p-2/t11-,17?;;/m0../s1 |
| InChIKey | TWRIAOGNQASAJY-VIDJJZNNSA-L |
| XLogP | -6.26 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | -6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate?
The IUPAC name of dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate (CID 162645496) is dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate.
What is the SMILES notation for dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate?
The canonical SMILES for dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate is CC(C)C[C@H](NP([O-])(=S)c1ccccc1)C(=O)[O-].[Li+].[Li+].
What is the InChIKey of dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate?
The InChIKey is TWRIAOGNQASAJY-VIDJJZNNSA-L. The full InChI is InChI=1S/C12H18NO3PS.2Li/c1-9(2)8-11(12(14)15)13-17(16,18)10-6-4-3-5-7-10;;/h3-7,9,11H,8H2,1-2H3,(H,14,15)(H2,13,16,18);;/q;2*+1/p-2/t11-,17?;;/m0../s1.
What are the key properties of dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate?
dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate has a molecular weight of 299.19 g/mol, XLogP of -6.26, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;(2S)-4-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]pentanoate is sourced from PubChem (CID 162645496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).