C28H28ClF2N3O4 — CID 162645714
6-chloro-7-[6-[[5-(2,4-difluorophenoxy)-1,3-dimethylpyrazol-4-yl]methylideneamino]hexoxy]-4-methylchromen-2-one (PubChem CID 162645714) has the molecular formula C28H28ClF2N3O4 and a molecular weight of 544.00 g/mol. Its IUPAC name is 6-chloro-7-[6-[[5-(2,4-difluorophenoxy)-1,3-dimethylpyrazol-4-yl]methylideneamino]hexoxy]-4-methylchromen-2-one.
| Compound Name | 6-chloro-7-[6-[[5-(2,4-difluorophenoxy)-1,3-dimethylpyrazol-4-yl]methylideneamino]hexoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 162645714 |
| Molecular Formula | C28H28ClF2N3O4 |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | 6-chloro-7-[6-[[5-(2,4-difluorophenoxy)-1,3-dimethylpyrazol-4-yl]methylideneamino]hexoxy]-4-methylchromen-2-one |
| SMILES | Cc1nn(C)c(Oc2ccc(F)cc2F)c1/C=N/CCCCCCOc1cc2oc(=O)cc(C)c2cc1Cl |
| InChI | InChI=1S/C28H28ClF2N3O4/c1-17-12-27(35)37-25-15-26(22(29)14-20(17)25)36-11-7-5-4-6-10-32-16-21-18(2)33-34(3)28(21)38-24-9-8-19(30)13-23(24)31/h8-9,12-16H,4-7,10-11H2,1-3H3/b32-16+ |
| InChIKey | GFMIJQVHWAYVGB-KPGMTVGESA-N |
| XLogP | 6.93 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|