C31H23ClN4O2 — CID 162645798
(Z,1E,4E)-1-[4-[(2-chlorophenyl)methoxy]phenyl]-5-pyridin-2-yl-N-quinazolin-4-yloxypenta-1,4-dien-3-imine (PubChem CID 162645798) has the molecular formula C31H23ClN4O2 and a molecular weight of 519.00 g/mol. Its IUPAC name is (Z,1E,4E)-1-[4-[(2-chlorophenyl)methoxy]phenyl]-5-pyridin-2-yl-N-quinazolin-4-yloxypenta-1,4-dien-3-imine.
| Compound Name | (Z,1E,4E)-1-[4-[(2-chlorophenyl)methoxy]phenyl]-5-pyridin-2-yl-N-quinazolin-4-yloxypenta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 162645798 |
| Molecular Formula | C31H23ClN4O2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (Z,1E,4E)-1-[4-[(2-chlorophenyl)methoxy]phenyl]-5-pyridin-2-yl-N-quinazolin-4-yloxypenta-1,4-dien-3-imine |
| SMILES | Clc1ccccc1COc1ccc(/C=C/C(/C=C/c2ccccn2)=N/Oc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C31H23ClN4O2/c32-29-10-3-1-7-24(29)21-37-27-18-13-23(14-19-27)12-15-26(17-16-25-8-5-6-20-33-25)36-38-31-28-9-2-4-11-30(28)34-22-35-31/h1-20,22H,21H2/b15-12+,17-16+,36-26- |
| InChIKey | UXMTXJUFAXZHSO-KCPNNQGWSA-N |
| XLogP | 7.42 |
| TPSA | 69.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|