C30H51NO — CID 162645858
(9Z,12Z)-N-[1-(1-adamantyl)ethyl]octadeca-9,12-dienamide (PubChem CID 162645858) has the molecular formula C30H51NO and a molecular weight of 441.74 g/mol. Its IUPAC name is (9Z,12Z)-N-[1-(1-adamantyl)ethyl]octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-[1-(1-adamantyl)ethyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 162645858 |
| Molecular Formula | C30H51NO |
| Molecular Weight | 441.74 g/mol |
| Exact Mass | 441.40 |
| IUPAC Name | (9Z,12Z)-N-[1-(1-adamantyl)ethyl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H51NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-29(32)31-25(2)30-22-26-19-27(23-30)21-28(20-26)24-30/h7-8,10-11,25-28H,3-6,9,12-24H2,1-2H3,(H,31,32)/b8-7-,11-10- |
| InChIKey | GGWBHJSWJVWPTF-NQLNTKRDSA-N |
| XLogP | 8.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.74 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|