About 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide
3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide (PubChem CID 162645884) has the molecular formula C21H22N2O5S2
and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide.
Molecular Properties
| Compound Name | 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide |
| PubChem CID | 162645884 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1S(=O)(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H22N2O5S2/c1-28-20-13-12-19(29(22,24)25)14-21(20)30(26,27)23(15-17-8-4-2-5-9-17)16-18-10-6-3-7-11-18/h2-14H,15-16H2,1H3,(H2,22,24,25) |
| InChIKey | FQWYYKJEIKSHRM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide?
The IUPAC name of 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide (CID 162645884) is 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide.
What is the SMILES notation for 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide?
The canonical SMILES for 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide is COc1ccc(S(N)(=O)=O)cc1S(=O)(=O)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide?
The InChIKey is FQWYYKJEIKSHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O5S2/c1-28-20-13-12-19(29(22,24)25)14-21(20)30(26,27)23(15-17-8-4-2-5-9-17)16-18-10-6-3-7-11-18/h2-14H,15-16H2,1H3,(H2,22,24,25).
What are the key properties of 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide?
3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide has a molecular weight of 446.55 g/mol, XLogP of 2.73, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-dibenzyl-4-methoxybenzene-1,3-disulfonamide is sourced from PubChem (CID 162645884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).