C15H18N4O3 — CID 162645940
(3S,4S)-1-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-3,4-diol (PubChem CID 162645940) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is (3S,4S)-1-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-3,4-diol.
| Compound Name | (3S,4S)-1-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 162645940 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (3S,4S)-1-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-3,4-diol |
| SMILES | Nc1nnc(-c2ccccc2O)cc1N1CC[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C15H18N4O3/c16-15-11(19-6-5-13(21)14(22)8-19)7-10(17-18-15)9-3-1-2-4-12(9)20/h1-4,7,13-14,20-22H,5-6,8H2,(H2,16,18)/t13-,14-/m0/s1 |
| InChIKey | QDSVGQOZFIDYIH-KBPBESRZSA-N |
| XLogP | 0.36 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |