C17H18O5 — CID 162645986
[(1S,2S,9R,10R,12S)-4,9-dimethyl-13-methylidene-5-oxo-6,14-dioxatetracyclo[7.5.0.03,7.010,12]tetradeca-3,7-dien-2-yl] acetate (PubChem CID 162645986) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(1S,2S,9R,10R,12S)-4,9-dimethyl-13-methylidene-5-oxo-6,14-dioxatetracyclo[7.5.0.03,7.010,12]tetradeca-3,7-dien-2-yl] acetate.
| Compound Name | [(1S,2S,9R,10R,12S)-4,9-dimethyl-13-methylidene-5-oxo-6,14-dioxatetracyclo[7.5.0.03,7.010,12]tetradeca-3,7-dien-2-yl] acetate |
|---|---|
| PubChem CID | 162645986 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [(1S,2S,9R,10R,12S)-4,9-dimethyl-13-methylidene-5-oxo-6,14-dioxatetracyclo[7.5.0.03,7.010,12]tetradeca-3,7-dien-2-yl] acetate |
| SMILES | C=C1O[C@@H]2[C@@H](OC(C)=O)C3=C(C)C(=O)OC3=C[C@@]2(C)[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C17H18O5/c1-7-13-12(22-16(7)19)6-17(4)11-5-10(11)8(2)20-15(17)14(13)21-9(3)18/h6,10-11,14-15H,2,5H2,1,3-4H3/t10-,11-,14+,15-,17+/m1/s1 |
| InChIKey | HBJAPGXWLUJBPF-IYPIUBDMSA-N |
| XLogP | 2.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |