About N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide
N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide (PubChem CID 162646023) has the molecular formula C16H17N5O3S
and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide |
| PubChem CID | 162646023 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide |
| SMILES | Cc1cc(C)n(-c2nc(-c3ccc(NS(C)(=O)=O)cc3)cc(=O)[nH]2)n1 |
| InChI | InChI=1S/C16H17N5O3S/c1-10-8-11(2)21(19-10)16-17-14(9-15(22)18-16)12-4-6-13(7-5-12)20-25(3,23)24/h4-9,20H,1-3H3,(H,17,18,22) |
| InChIKey | SIOIVRQBNSBLBW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide?
The IUPAC name of N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide (CID 162646023) is N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide?
The canonical SMILES for N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide is Cc1cc(C)n(-c2nc(-c3ccc(NS(C)(=O)=O)cc3)cc(=O)[nH]2)n1.
What is the InChIKey of N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide?
The InChIKey is SIOIVRQBNSBLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O3S/c1-10-8-11(2)21(19-10)16-17-14(9-15(22)18-16)12-4-6-13(7-5-12)20-25(3,23)24/h4-9,20H,1-3H3,(H,17,18,22).
What are the key properties of N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide?
N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide has a molecular weight of 359.41 g/mol, XLogP of 1.61, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-(3,5-dimethylpyrazol-1-yl)-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide is sourced from PubChem (CID 162646023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).