C17H16F3N5O2 — CID 162646044
N-[(2S)-1-(cyanomethylamino)-1-oxo-3-phenylpropan-2-yl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 162646044) has the molecular formula C17H16F3N5O2 and a molecular weight of 379.34 g/mol. Its IUPAC name is N-[(2S)-1-(cyanomethylamino)-1-oxo-3-phenylpropan-2-yl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-[(2S)-1-(cyanomethylamino)-1-oxo-3-phenylpropan-2-yl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 162646044 |
| Molecular Formula | C17H16F3N5O2 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[(2S)-1-(cyanomethylamino)-1-oxo-3-phenylpropan-2-yl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)cc1C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC#N |
| InChI | InChI=1S/C17H16F3N5O2/c1-25-13(10-14(24-25)17(18,19)20)16(27)23-12(15(26)22-8-7-21)9-11-5-3-2-4-6-11/h2-6,10,12H,8-9H2,1H3,(H,22,26)(H,23,27)/t12-/m0/s1 |
| InChIKey | YKPKPKHKNVWVBV-LBPRGKRZSA-N |
| XLogP | 1.42 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|