C23H18O6 — CID 162646068
dimethyl 5,8-dioxo-6-phenyl-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate (PubChem CID 162646068) has the molecular formula C23H18O6 and a molecular weight of 390.39 g/mol. Its IUPAC name is dimethyl 5,8-dioxo-6-phenyl-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate.
| Compound Name | dimethyl 5,8-dioxo-6-phenyl-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 162646068 |
| Molecular Formula | C23H18O6 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | dimethyl 5,8-dioxo-6-phenyl-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc3c(cc2C1)C(=O)C(c1ccccc1)=CC3=O |
| InChI | InChI=1S/C23H18O6/c1-28-21(26)23(22(27)29-2)11-14-8-17-18(9-15(14)12-23)20(25)16(10-19(17)24)13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3 |
| InChIKey | OKMAFFJWEVRWEM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|